C18H31ClO — CID 5365578
(9E,12E)-octadeca-9,12-dienoyl chloride (PubChem CID 5365578) has the molecular formula C18H31ClO and a molecular weight of 298.90 g/mol. Its IUPAC name is (9E,12E)-octadeca-9,12-dienoyl chloride.
| Compound Name | (9E,12E)-octadeca-9,12-dienoyl chloride |
|---|---|
| PubChem CID | 5365578 |
| Molecular Formula | C18H31ClO |
| Molecular Weight | 298.90 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (9E,12E)-octadeca-9,12-dienoyl chloride |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)Cl |
| InChI | InChI=1S/C18H31ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3/b7-6+,10-9+ |
| InChIKey | FBWMYSQUTZRHAT-AVQMFFATSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.90 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|