About [(7Z,9Z)-dodeca-7,9-dienyl] acetate
[(7Z,9Z)-dodeca-7,9-dienyl] acetate (PubChem CID 5365702) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is [(7Z,9Z)-dodeca-7,9-dienyl] acetate.
Molecular Properties
| Compound Name | [(7Z,9Z)-dodeca-7,9-dienyl] acetate |
| PubChem CID | 5365702 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | [(7Z,9Z)-dodeca-7,9-dienyl] acetate |
| SMILES | CC/C=C\C=C/CCCCCCOC(C)=O |
| InChI | InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-7H,3,8-13H2,1-2H3/b5-4-,7-6- |
| InChIKey | LLRZUAWETKPZJO-RZSVFLSASA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(7Z,9Z)-dodeca-7,9-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7Z,9Z)-dodeca-7,9-dienyl] acetate?
The IUPAC name of [(7Z,9Z)-dodeca-7,9-dienyl] acetate (CID 5365702) is [(7Z,9Z)-dodeca-7,9-dienyl] acetate.
What is the SMILES notation for [(7Z,9Z)-dodeca-7,9-dienyl] acetate?
The canonical SMILES for [(7Z,9Z)-dodeca-7,9-dienyl] acetate is CC/C=C\C=C/CCCCCCOC(C)=O.
What is the InChIKey of [(7Z,9Z)-dodeca-7,9-dienyl] acetate?
The InChIKey is LLRZUAWETKPZJO-RZSVFLSASA-N. The full InChI is InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-7H,3,8-13H2,1-2H3/b5-4-,7-6-.
What are the key properties of [(7Z,9Z)-dodeca-7,9-dienyl] acetate?
[(7Z,9Z)-dodeca-7,9-dienyl] acetate has a molecular weight of 224.34 g/mol, XLogP of 4.02, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(7Z,9Z)-dodeca-7,9-dienyl] acetate is sourced from PubChem (CID 5365702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).