C5H2F6O2 — CID 5365726
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one (PubChem CID 5365726) has the molecular formula C5H2F6O2 and a molecular weight of 208.06 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 5365726 |
| Molecular Formula | C5H2F6O2 |
| Molecular Weight | 208.06 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F6O2/c6-4(7,8)2(12)1-3(13)5(9,10)11/h1,12H/b2-1- |
| InChIKey | ZUSKFDORJCVUSD-UPHRSURJSA-N |
| XLogP | 2.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.06 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|