C15H24 — CID 5365777
(1Z,5Z,9Z)-1,5,9-trimethylcyclododeca-1,5,9-triene (PubChem CID 5365777) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (1Z,5Z,9Z)-1,5,9-trimethylcyclododeca-1,5,9-triene.
| Compound Name | (1Z,5Z,9Z)-1,5,9-trimethylcyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 5365777 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (1Z,5Z,9Z)-1,5,9-trimethylcyclododeca-1,5,9-triene |
| SMILES | C/C1=C/CC/C(C)=C\CC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H24/c1-13-7-4-9-14(2)11-6-12-15(3)10-5-8-13/h7,10-11H,4-6,8-9,12H2,1-3H3/b13-7-,14-11-,15-10- |
| InChIKey | XOTMHDVYZZBKEJ-PEFAHGPYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|