About (5E)-4-methylhepta-1,5-diene
(5E)-4-methylhepta-1,5-diene (PubChem CID 5365804) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is (5E)-4-methylhepta-1,5-diene.
Molecular Properties
| Compound Name | (5E)-4-methylhepta-1,5-diene |
| PubChem CID | 5365804 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (5E)-4-methylhepta-1,5-diene |
| SMILES | C=CCC(C)/C=C/C |
| InChI | InChI=1S/C8H14/c1-4-6-8(3)7-5-2/h4-5,7-8H,1,6H2,2-3H3/b7-5+ |
| InChIKey | ITKKJSFRRSLPHX-FNORWQNLSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-4-methylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-4-methylhepta-1,5-diene?
The IUPAC name of (5E)-4-methylhepta-1,5-diene (CID 5365804) is (5E)-4-methylhepta-1,5-diene.
What is the SMILES notation for (5E)-4-methylhepta-1,5-diene?
The canonical SMILES for (5E)-4-methylhepta-1,5-diene is C=CCC(C)/C=C/C.
What is the InChIKey of (5E)-4-methylhepta-1,5-diene?
The InChIKey is ITKKJSFRRSLPHX-FNORWQNLSA-N. The full InChI is InChI=1S/C8H14/c1-4-6-8(3)7-5-2/h4-5,7-8H,1,6H2,2-3H3/b7-5+.
What are the key properties of (5E)-4-methylhepta-1,5-diene?
(5E)-4-methylhepta-1,5-diene has a molecular weight of 110.20 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-4-methylhepta-1,5-diene is sourced from PubChem (CID 5365804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).