About (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene
(2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene (PubChem CID 5365842) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene |
| PubChem CID | 5365842 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene |
| SMILES | C=COC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O/c1-5-13-10-9-12(4)8-6-7-11(2)3/h5,7,9H,1,6,8,10H2,2-4H3/b12-9+ |
| InChIKey | YBKJFYRRNMFOPP-FMIVXFBMSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene (CID 5365842) is (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene is C=COC/C=C(\C)CCC=C(C)C.
What is the InChIKey of (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene?
The InChIKey is YBKJFYRRNMFOPP-FMIVXFBMSA-N. The full InChI is InChI=1S/C12H20O/c1-5-13-10-9-12(4)8-6-7-11(2)3/h5,7,9H,1,6,8,10H2,2-4H3/b12-9+.
What are the key properties of (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene?
(2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene has a molecular weight of 180.29 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-ethenoxy-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 5365842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).