C16H28O — CID 5365855
(2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 5365855) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | (2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 5365855 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | COC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H28O/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-17-5/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+ |
| InChIKey | HZDZRGKULMGCJE-NCZFFCEISA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|