About 3,7-dimethyloct-6-enyl (E)-but-2-enoate
3,7-dimethyloct-6-enyl (E)-but-2-enoate (PubChem CID 5365882) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl (E)-but-2-enoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl (E)-but-2-enoate |
| PubChem CID | 5365882 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,7-dimethyloct-6-enyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C14H24O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h5,7-8,13H,6,9-11H2,1-4H3/b7-5+ |
| InChIKey | MYGZJMACIRJNPL-FNORWQNLSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl (E)-but-2-enoate?
The IUPAC name of 3,7-dimethyloct-6-enyl (E)-but-2-enoate (CID 5365882) is 3,7-dimethyloct-6-enyl (E)-but-2-enoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl (E)-but-2-enoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl (E)-but-2-enoate is C/C=C/C(=O)OCCC(C)CCC=C(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl (E)-but-2-enoate?
The InChIKey is MYGZJMACIRJNPL-FNORWQNLSA-N. The full InChI is InChI=1S/C14H24O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h5,7-8,13H,6,9-11H2,1-4H3/b7-5+.
What are the key properties of 3,7-dimethyloct-6-enyl (E)-but-2-enoate?
3,7-dimethyloct-6-enyl (E)-but-2-enoate has a molecular weight of 224.34 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl (E)-but-2-enoate is sourced from PubChem (CID 5365882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).