C20H32 — CID 5365883
(3E,6E,10E)-3,7,11,15-tetramethylhexadeca-1,3,6,10,14-pentaene (PubChem CID 5365883) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (3E,6E,10E)-3,7,11,15-tetramethylhexadeca-1,3,6,10,14-pentaene.
| Compound Name | (3E,6E,10E)-3,7,11,15-tetramethylhexadeca-1,3,6,10,14-pentaene |
|---|---|
| PubChem CID | 5365883 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (3E,6E,10E)-3,7,11,15-tetramethylhexadeca-1,3,6,10,14-pentaene |
| SMILES | C=C/C(C)=C/C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H32/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,11-12,14-15H,1,8-10,13,16H2,2-6H3/b18-12+,19-15+,20-14+ |
| InChIKey | KFHRKQVLZRJWNB-OBHWEXPVSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|