C15H25NO — CID 5365884
(NE)-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienylidene]hydroxylamine (PubChem CID 5365884) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (NE)-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienylidene]hydroxylamine |
|---|---|
| PubChem CID | 5365884 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (NE)-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienylidene]hydroxylamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=N/O |
| InChI | InChI=1S/C15H25NO/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16-17/h7,9,11-12,17H,5-6,8,10H2,1-4H3/b14-9+,15-11+,16-12+ |
| InChIKey | NJTRDUDZKFPSBJ-GDXIMDLHSA-N |
| XLogP | 4.87 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|