About (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol
(2Z)-2-(3,3-dimethylcyclohexylidene)ethanol (PubChem CID 5365896) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol.
Molecular Properties
| Compound Name | (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol |
| PubChem CID | 5365896 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol |
| SMILES | CC1(C)CCC/C(=C/CO)C1 |
| InChI | InChI=1S/C10H18O/c1-10(2)6-3-4-9(8-10)5-7-11/h5,11H,3-4,6-8H2,1-2H3/b9-5- |
| InChIKey | SHYLMMBHTKLAJS-UITAMQMPSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol?
The IUPAC name of (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol (CID 5365896) is (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol.
What is the SMILES notation for (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol?
The canonical SMILES for (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol is CC1(C)CCC/C(=C/CO)C1.
What is the InChIKey of (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol?
The InChIKey is SHYLMMBHTKLAJS-UITAMQMPSA-N. The full InChI is InChI=1S/C10H18O/c1-10(2)6-3-4-9(8-10)5-7-11/h5,11H,3-4,6-8H2,1-2H3/b9-5-.
What are the key properties of (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol?
(2Z)-2-(3,3-dimethylcyclohexylidene)ethanol has a molecular weight of 154.25 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3,3-dimethylcyclohexylidene)ethanol is sourced from PubChem (CID 5365896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).