About (4E)-5,9-dimethyldeca-4,8-dien-3-ol
(4E)-5,9-dimethyldeca-4,8-dien-3-ol (PubChem CID 5365900) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is (4E)-5,9-dimethyldeca-4,8-dien-3-ol.
Molecular Properties
| Compound Name | (4E)-5,9-dimethyldeca-4,8-dien-3-ol |
| PubChem CID | 5365900 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (4E)-5,9-dimethyldeca-4,8-dien-3-ol |
| SMILES | CCC(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h7,9,12-13H,5-6,8H2,1-4H3/b11-9+ |
| InChIKey | PQUSMVMWVMGVGN-PKNBQFBNSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5,9-dimethyldeca-4,8-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5,9-dimethyldeca-4,8-dien-3-ol?
The IUPAC name of (4E)-5,9-dimethyldeca-4,8-dien-3-ol (CID 5365900) is (4E)-5,9-dimethyldeca-4,8-dien-3-ol.
What is the SMILES notation for (4E)-5,9-dimethyldeca-4,8-dien-3-ol?
The canonical SMILES for (4E)-5,9-dimethyldeca-4,8-dien-3-ol is CCC(O)/C=C(\C)CCC=C(C)C.
What is the InChIKey of (4E)-5,9-dimethyldeca-4,8-dien-3-ol?
The InChIKey is PQUSMVMWVMGVGN-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H22O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h7,9,12-13H,5-6,8H2,1-4H3/b11-9+.
What are the key properties of (4E)-5,9-dimethyldeca-4,8-dien-3-ol?
(4E)-5,9-dimethyldeca-4,8-dien-3-ol has a molecular weight of 182.31 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5,9-dimethyldeca-4,8-dien-3-ol is sourced from PubChem (CID 5365900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).