About methyl (2Z)-3,7-dimethylocta-2,6-dienoate
methyl (2Z)-3,7-dimethylocta-2,6-dienoate (PubChem CID 5365912) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is methyl (2Z)-3,7-dimethylocta-2,6-dienoate.
Molecular Properties
| Compound Name | methyl (2Z)-3,7-dimethylocta-2,6-dienoate |
| PubChem CID | 5365912 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | methyl (2Z)-3,7-dimethylocta-2,6-dienoate |
| SMILES | COC(=O)/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8- |
| InChIKey | ACOBBFVLNKYODD-NTMALXAHSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-3,7-dimethylocta-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-3,7-dimethylocta-2,6-dienoate?
The IUPAC name of methyl (2Z)-3,7-dimethylocta-2,6-dienoate (CID 5365912) is methyl (2Z)-3,7-dimethylocta-2,6-dienoate.
What is the SMILES notation for methyl (2Z)-3,7-dimethylocta-2,6-dienoate?
The canonical SMILES for methyl (2Z)-3,7-dimethylocta-2,6-dienoate is COC(=O)/C=C(/C)CCC=C(C)C.
What is the InChIKey of methyl (2Z)-3,7-dimethylocta-2,6-dienoate?
The InChIKey is ACOBBFVLNKYODD-NTMALXAHSA-N. The full InChI is InChI=1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8-.
What are the key properties of methyl (2Z)-3,7-dimethylocta-2,6-dienoate?
methyl (2Z)-3,7-dimethylocta-2,6-dienoate has a molecular weight of 182.26 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-3,7-dimethylocta-2,6-dienoate is sourced from PubChem (CID 5365912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).