About [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate (PubChem CID 5365991) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate |
| PubChem CID | 5365991 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)C(C)C |
| InChI | InChI=1S/C14H24O2/c1-11(2)7-6-8-13(5)9-10-16-14(15)12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9- |
| InChIKey | OGJYXQFXLSCKTP-LCYFTJDESA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate (CID 5365991) is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate is CC(C)=CCC/C(C)=C\COC(=O)C(C)C.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate?
The InChIKey is OGJYXQFXLSCKTP-LCYFTJDESA-N. The full InChI is InChI=1S/C14H24O2/c1-11(2)7-6-8-13(5)9-10-16-14(15)12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate has a molecular weight of 224.34 g/mol, XLogP of 3.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylpropanoate is sourced from PubChem (CID 5365991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).