C4HBrF6 — CID 5366001
(Z)-2-bromo-1,1,1,4,4,4-hexafluorobut-2-ene (PubChem CID 5366001) has the molecular formula C4HBrF6 and a molecular weight of 242.94 g/mol. Its IUPAC name is (Z)-2-bromo-1,1,1,4,4,4-hexafluorobut-2-ene.
| Compound Name | (Z)-2-bromo-1,1,1,4,4,4-hexafluorobut-2-ene |
|---|---|
| PubChem CID | 5366001 |
| Molecular Formula | C4HBrF6 |
| Molecular Weight | 242.94 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | (Z)-2-bromo-1,1,1,4,4,4-hexafluorobut-2-ene |
| SMILES | FC(F)(F)/C=C(\Br)C(F)(F)F |
| InChI | InChI=1S/C4HBrF6/c5-2(4(9,10)11)1-3(6,7)8/h1H/b2-1- |
| InChIKey | KSWYRKGFPCBMHX-UPHRSURJSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |