C25H42B2O6 — CID 5366026
2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-[(6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole (PubChem CID 5366026) has the molecular formula C25H42B2O6 and a molecular weight of 460.23 g/mol. Its IUPAC name is 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-[(6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole.
| Compound Name | 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-[(6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 5366026 |
| Molecular Formula | C25H42B2O6 |
| Molecular Weight | 460.23 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-[(6Z)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole |
| SMILES | C=CC(C)(CC/C=C(/C)CCC=C(C)C)OC1OC(C2COB(CC)O2)C2OB(CC)OC12 |
| InChI | InChI=1S/C25H42B2O6/c1-8-25(7,16-12-15-19(6)14-11-13-18(4)5)30-24-23-22(32-27(10-3)33-23)21(29-24)20-17-28-26(9-2)31-20/h8,13,15,20-24H,1,9-12,14,16-17H2,2-7H3/b19-15- |
| InChIKey | MHHWPLUXDJNDKI-CYVLTUHYSA-N |
| XLogP | 5.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|