About 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran (PubChem CID 5366078) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran.
Molecular Properties
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran |
| PubChem CID | 5366078 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran |
| SMILES | CC(C)=CCC/C(C)=C/Cc1occc1C |
| InChI | InChI=1S/C15H22O/c1-12(2)6-5-7-13(3)8-9-15-14(4)10-11-16-15/h6,8,10-11H,5,7,9H2,1-4H3/b13-8+ |
| InChIKey | CKUQXDUZAWSPOV-MDWZMJQESA-N |
| XLogP | 4.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran?
The IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran (CID 5366078) is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran.
What is the SMILES notation for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran?
The canonical SMILES for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran is CC(C)=CCC/C(C)=C/Cc1occc1C.
What is the InChIKey of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran?
The InChIKey is CKUQXDUZAWSPOV-MDWZMJQESA-N. The full InChI is InChI=1S/C15H22O/c1-12(2)6-5-7-13(3)8-9-15-14(4)10-11-16-15/h6,8,10-11H,5,7,9H2,1-4H3/b13-8+.
What are the key properties of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran?
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran has a molecular weight of 218.34 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methylfuran is sourced from PubChem (CID 5366078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).