C10H16O3 — CID 5366152
(6E)-8-hydroxy-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 5366152) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (6E)-8-hydroxy-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (6E)-8-hydroxy-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 5366152 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (6E)-8-hydroxy-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC1CCC/C=C/C(O)CC(=O)O1 |
| InChI | InChI=1S/C10H16O3/c1-8-5-3-2-4-6-9(11)7-10(12)13-8/h4,6,8-9,11H,2-3,5,7H2,1H3/b6-4+ |
| InChIKey | QBMOXZAUNMFTMZ-GQCTYLIASA-N |
| XLogP | 1.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|