C20H40 — CID 5366161
(E)-3,7,11,15-tetramethylhexadec-2-ene (PubChem CID 5366161) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is (E)-3,7,11,15-tetramethylhexadec-2-ene.
| Compound Name | (E)-3,7,11,15-tetramethylhexadec-2-ene |
|---|---|
| PubChem CID | 5366161 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | (E)-3,7,11,15-tetramethylhexadec-2-ene |
| SMILES | C/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H40/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17,19-20H,8-16H2,1-6H3/b18-7+ |
| InChIKey | XZJQZWIDAHFTHV-CNHKJKLMSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|