C20H35N — CID 5366167
(3E)-N-(2,7-dimethylocta-1,7-dien-3-yl)-8-methylnona-3,8-dien-2-amine (PubChem CID 5366167) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (3E)-N-(2,7-dimethylocta-1,7-dien-3-yl)-8-methylnona-3,8-dien-2-amine.
| Compound Name | (3E)-N-(2,7-dimethylocta-1,7-dien-3-yl)-8-methylnona-3,8-dien-2-amine |
|---|---|
| PubChem CID | 5366167 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (3E)-N-(2,7-dimethylocta-1,7-dien-3-yl)-8-methylnona-3,8-dien-2-amine |
| SMILES | C=C(C)CCC/C=C/C(C)NC(CCCC(=C)C)C(=C)C |
| InChI | InChI=1S/C20H35N/c1-16(2)12-9-8-10-14-19(7)21-20(18(5)6)15-11-13-17(3)4/h10,14,19-21H,1,3,5,8-9,11-13,15H2,2,4,6-7H3/b14-10+ |
| InChIKey | SYGIYKKQXRHJEN-GXDHUFHOSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|