C16H29NO — CID 5366186
(6Z)-8-methyl-6-(2-methylhexylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 5366186) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (6Z)-8-methyl-6-(2-methylhexylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z)-8-methyl-6-(2-methylhexylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 5366186 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (6Z)-8-methyl-6-(2-methylhexylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | CCCCC(C)/C=C1\CN2CCCC2C(C)(O)C1 |
| InChI | InChI=1S/C16H29NO/c1-4-5-7-13(2)10-14-11-16(3,18)15-8-6-9-17(15)12-14/h10,13,15,18H,4-9,11-12H2,1-3H3/b14-10- |
| InChIKey | OKTQTXDNHCOLHT-UVTDQMKNSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|