C16H29NO2 — CID 5366188
(6Z)-6-(5-hydroxy-2-methylhexylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 5366188) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (6Z)-6-(5-hydroxy-2-methylhexylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z)-6-(5-hydroxy-2-methylhexylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 5366188 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (6Z)-6-(5-hydroxy-2-methylhexylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | CC(O)CCC(C)/C=C1\CN2CCCC2C(C)(O)C1 |
| InChI | InChI=1S/C16H29NO2/c1-12(6-7-13(2)18)9-14-10-16(3,19)15-5-4-8-17(15)11-14/h9,12-13,15,18-19H,4-8,10-11H2,1-3H3/b14-9- |
| InChIKey | JKLNTQRRLOXRDE-ZROIWOOFSA-N |
| XLogP | 2.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|