About (E)-N,N,2-trimethylhex-3-enamide
(E)-N,N,2-trimethylhex-3-enamide (PubChem CID 5366309) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (E)-N,N,2-trimethylhex-3-enamide.
Molecular Properties
| Compound Name | (E)-N,N,2-trimethylhex-3-enamide |
| PubChem CID | 5366309 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (E)-N,N,2-trimethylhex-3-enamide |
| SMILES | CC/C=C/C(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H17NO/c1-5-6-7-8(2)9(11)10(3)4/h6-8H,5H2,1-4H3/b7-6+ |
| InChIKey | QFCYIPIYALIUOZ-VOTSOKGWSA-N |
| XLogP | 1.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N,2-trimethylhex-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N,2-trimethylhex-3-enamide?
The IUPAC name of (E)-N,N,2-trimethylhex-3-enamide (CID 5366309) is (E)-N,N,2-trimethylhex-3-enamide.
What is the SMILES notation for (E)-N,N,2-trimethylhex-3-enamide?
The canonical SMILES for (E)-N,N,2-trimethylhex-3-enamide is CC/C=C/C(C)C(=O)N(C)C.
What is the InChIKey of (E)-N,N,2-trimethylhex-3-enamide?
The InChIKey is QFCYIPIYALIUOZ-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H17NO/c1-5-6-7-8(2)9(11)10(3)4/h6-8H,5H2,1-4H3/b7-6+.
What are the key properties of (E)-N,N,2-trimethylhex-3-enamide?
(E)-N,N,2-trimethylhex-3-enamide has a molecular weight of 155.24 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N,2-trimethylhex-3-enamide is sourced from PubChem (CID 5366309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).