C8H14N4 — CID 536642
3,6-di(propan-2-yl)-1,2,4,5-tetrazine (PubChem CID 536642) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 3,6-di(propan-2-yl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-di(propan-2-yl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 536642 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3,6-di(propan-2-yl)-1,2,4,5-tetrazine |
| SMILES | CC(C)c1nnc(C(C)C)nn1 |
| InChI | InChI=1S/C8H14N4/c1-5(2)7-9-11-8(6(3)4)12-10-7/h5-6H,1-4H3 |
| InChIKey | HIHLOTXWVCLNEX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |