About [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane
[(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane (PubChem CID 5366448) has the molecular formula C8H16O2Si
and a molecular weight of 172.30 g/mol. Its IUPAC name is [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane |
| PubChem CID | 5366448 |
| Molecular Formula | C8H16O2Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane |
| SMILES | C=C(/C=C/OC)O[Si](C)(C)C |
| InChI | InChI=1S/C8H16O2Si/c1-8(6-7-9-2)10-11(3,4)5/h6-7H,1H2,2-5H3/b7-6+ |
| InChIKey | SHALBPKEGDBVKK-VOTSOKGWSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane?
The IUPAC name of [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane (CID 5366448) is [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane.
What is the SMILES notation for [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane?
The canonical SMILES for [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane is C=C(/C=C/OC)O[Si](C)(C)C.
What is the InChIKey of [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane?
The InChIKey is SHALBPKEGDBVKK-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H16O2Si/c1-8(6-7-9-2)10-11(3,4)5/h6-7H,1H2,2-5H3/b7-6+.
What are the key properties of [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane?
[(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane has a molecular weight of 172.30 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4-methoxybuta-1,3-dien-2-yl]oxy-trimethylsilane is sourced from PubChem (CID 5366448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).