About [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane
[(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane (PubChem CID 5366544) has the molecular formula C11H22Si
and a molecular weight of 182.38 g/mol. Its IUPAC name is [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane |
| PubChem CID | 5366544 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane |
| SMILES | CC1(C)CCC/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C11H22Si/c1-11(2)8-6-7-10(11)9-12(3,4)5/h9H,6-8H2,1-5H3/b10-9+ |
| InChIKey | IZNIRRNKJUEFMM-MDZDMXLPSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane?
The IUPAC name of [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane (CID 5366544) is [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane.
What is the SMILES notation for [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane?
The canonical SMILES for [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane is CC1(C)CCC/C1=C\[Si](C)(C)C.
What is the InChIKey of [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane?
The InChIKey is IZNIRRNKJUEFMM-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H22Si/c1-11(2)8-6-7-10(11)9-12(3,4)5/h9H,6-8H2,1-5H3/b10-9+.
What are the key properties of [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane?
[(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane has a molecular weight of 182.38 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2,2-dimethylcyclopentylidene)methyl]-trimethylsilane is sourced from PubChem (CID 5366544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).