C12H26Si2 — CID 5366555
[(1E,3E)-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane (PubChem CID 5366555) has the molecular formula C12H26Si2 and a molecular weight of 226.51 g/mol. Its IUPAC name is [(1E,3E)-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E,3E)-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 5366555 |
| Molecular Formula | C12H26Si2 |
| Molecular Weight | 226.51 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(1E,3E)-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
| SMILES | CC(=C\[Si](C)(C)C)/C(C)=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H26Si2/c1-11(9-13(3,4)5)12(2)10-14(6,7)8/h9-10H,1-8H3/b11-9+,12-10+ |
| InChIKey | WSNMCVXMICHREB-WGDLNXRISA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|