About trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane
trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane (PubChem CID 5366561) has the molecular formula C14H30Si2
and a molecular weight of 254.57 g/mol. Its IUPAC name is trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane |
| PubChem CID | 5366561 |
| Molecular Formula | C14H30Si2 |
| Molecular Weight | 254.57 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane |
| SMILES | C[Si](C)(C)C/C=C/CC/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C14H30Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h9-12H,7-8,13-14H2,1-6H3/b11-9+,12-10+ |
| InChIKey | UUPPIVRNYFRPLG-WGDLNXRISA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane?
The IUPAC name of trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane (CID 5366561) is trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane.
What is the SMILES notation for trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane?
The canonical SMILES for trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane is C[Si](C)(C)C/C=C/CC/C=C/C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane?
The InChIKey is UUPPIVRNYFRPLG-WGDLNXRISA-N. The full InChI is InChI=1S/C14H30Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h9-12H,7-8,13-14H2,1-6H3/b11-9+,12-10+.
What are the key properties of trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane?
trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane has a molecular weight of 254.57 g/mol, XLogP of 5.56, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2E,6E)-8-trimethylsilylocta-2,6-dienyl]silane is sourced from PubChem (CID 5366561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).