C31H62O5Si3 — CID 5366583
methyl (Z)-7-[2-[(E)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate (PubChem CID 5366583) has the molecular formula C31H62O5Si3 and a molecular weight of 599.09 g/mol. Its IUPAC name is methyl (Z)-7-[2-[(E)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[2-[(E)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 5366583 |
| Molecular Formula | C31H62O5Si3 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | methyl (Z)-7-[2-[(E)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(C)(/C=C/C1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1C/C=C\CCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C31H62O5Si3/c1-13-14-19-23-31(2,36-39(10,11)12)24-22-27-26(20-17-15-16-18-21-30(32)33-3)28(34-37(4,5)6)25-29(27)35-38(7,8)9/h15,17,22,24,26-29H,13-14,16,18-21,23,25H2,1-12H3/b17-15-,24-22+ |
| InChIKey | IFTWEWJEMOHVPM-XNYJDNTISA-N |
| XLogP | 9.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|