About bis(trimethylsilyl) (E)-hex-3-enedioate
bis(trimethylsilyl) (E)-hex-3-enedioate (PubChem CID 5366594) has the molecular formula C12H24O4Si2
and a molecular weight of 288.49 g/mol. Its IUPAC name is bis(trimethylsilyl) (E)-hex-3-enedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) (E)-hex-3-enedioate |
| PubChem CID | 5366594 |
| Molecular Formula | C12H24O4Si2 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | bis(trimethylsilyl) (E)-hex-3-enedioate |
| SMILES | C[Si](C)(C)OC(=O)C/C=C/CC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H24O4Si2/c1-17(2,3)15-11(13)9-7-8-10-12(14)16-18(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+ |
| InChIKey | ZHDWBZJDVFQQQO-BQYQJAHWSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) (E)-hex-3-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) (E)-hex-3-enedioate?
The IUPAC name of bis(trimethylsilyl) (E)-hex-3-enedioate (CID 5366594) is bis(trimethylsilyl) (E)-hex-3-enedioate.
What is the SMILES notation for bis(trimethylsilyl) (E)-hex-3-enedioate?
The canonical SMILES for bis(trimethylsilyl) (E)-hex-3-enedioate is C[Si](C)(C)OC(=O)C/C=C/CC(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) (E)-hex-3-enedioate?
The InChIKey is ZHDWBZJDVFQQQO-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H24O4Si2/c1-17(2,3)15-11(13)9-7-8-10-12(14)16-18(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+.
What are the key properties of bis(trimethylsilyl) (E)-hex-3-enedioate?
bis(trimethylsilyl) (E)-hex-3-enedioate has a molecular weight of 288.49 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) (E)-hex-3-enedioate is sourced from PubChem (CID 5366594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).