C17H36O3Si2 — CID 5366616
[tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enoate (PubChem CID 5366616) has the molecular formula C17H36O3Si2 and a molecular weight of 344.64 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 5366616 |
| Molecular Formula | C17H36O3Si2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (Z)-2-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
| SMILES | CC/C=C(\O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si2/c1-12-13-14(19-21(8,9)16(2,3)4)15(18)20-22(10,11)17(5,6)7/h13H,12H2,1-11H3/b14-13- |
| InChIKey | YOJIAVOJAOVKHP-YPKPFQOOSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|