C16H34Si2 — CID 5366659
trimethyl-[(E,3E)-2-propyl-3-(trimethylsilylmethylidene)hex-1-enyl]silane (PubChem CID 5366659) has the molecular formula C16H34Si2 and a molecular weight of 282.62 g/mol. Its IUPAC name is trimethyl-[(E,3E)-2-propyl-3-(trimethylsilylmethylidene)hex-1-enyl]silane.
| Compound Name | trimethyl-[(E,3E)-2-propyl-3-(trimethylsilylmethylidene)hex-1-enyl]silane |
|---|---|
| PubChem CID | 5366659 |
| Molecular Formula | C16H34Si2 |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | trimethyl-[(E,3E)-2-propyl-3-(trimethylsilylmethylidene)hex-1-enyl]silane |
| SMILES | CCCC(=C\[Si](C)(C)C)/C(=C/[Si](C)(C)C)CCC |
| InChI | InChI=1S/C16H34Si2/c1-9-11-15(13-17(3,4)5)16(12-10-2)14-18(6,7)8/h13-14H,9-12H2,1-8H3/b15-13+,16-14+ |
| InChIKey | AXEMIALFUQPCGB-WXUKJITCSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|