C27H54O4Si2 — CID 5366692
2,3-bis(trimethylsilyloxy)propyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 5366692) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is 2,3-bis(trimethylsilyloxy)propyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2,3-bis(trimethylsilyloxy)propyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 5366692 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | 2,3-bis(trimethylsilyloxy)propyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H54O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)29-24-26(31-33(5,6)7)25-30-32(2,3)4/h12-13,15-16,26H,8-11,14,17-25H2,1-7H3/b13-12-,16-15- |
| InChIKey | ZSJCVZNRVUZSFU-QGLGPCELSA-N |
| XLogP | 8.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|