C15H25NO3 — CID 536672
2'-hydroxy-1,2,2'-trimethylspiro[2,3,4a,5,6,7,8,8a-octahydroquinoline-4,5'-oxolane]-3'-one (PubChem CID 536672) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2'-hydroxy-1,2,2'-trimethylspiro[2,3,4a,5,6,7,8,8a-octahydroquinoline-4,5'-oxolane]-3'-one.
| Compound Name | 2'-hydroxy-1,2,2'-trimethylspiro[2,3,4a,5,6,7,8,8a-octahydroquinoline-4,5'-oxolane]-3'-one |
|---|---|
| PubChem CID | 536672 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2'-hydroxy-1,2,2'-trimethylspiro[2,3,4a,5,6,7,8,8a-octahydroquinoline-4,5'-oxolane]-3'-one |
| SMILES | CC1CC2(CC(=O)C(C)(O)O2)C2CCCCC2N1C |
| InChI | InChI=1S/C15H25NO3/c1-10-8-15(9-13(17)14(2,18)19-15)11-6-4-5-7-12(11)16(10)3/h10-12,18H,4-9H2,1-3H3 |
| InChIKey | SXAMPBZYHZZWRP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |