C26H53NO3Si2 — CID 5366776
N-[(4E,8E)-1,3-bis(trimethylsilyloxy)octadeca-4,8-dien-2-yl]acetamide (PubChem CID 5366776) has the molecular formula C26H53NO3Si2 and a molecular weight of 483.89 g/mol. Its IUPAC name is N-[(4E,8E)-1,3-bis(trimethylsilyloxy)octadeca-4,8-dien-2-yl]acetamide.
| Compound Name | N-[(4E,8E)-1,3-bis(trimethylsilyloxy)octadeca-4,8-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 5366776 |
| Molecular Formula | C26H53NO3Si2 |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 483.36 |
| IUPAC Name | N-[(4E,8E)-1,3-bis(trimethylsilyloxy)octadeca-4,8-dien-2-yl]acetamide |
| SMILES | CCCCCCCCC/C=C/CC/C=C/C(O[Si](C)(C)C)C(CO[Si](C)(C)C)NC(C)=O |
| InChI | InChI=1S/C26H53NO3Si2/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(30-32(6,7)8)25(27-24(2)28)23-29-31(3,4)5/h17-18,21-22,25-26H,9-16,19-20,23H2,1-8H3,(H,27,28)/b18-17+,22-21+ |
| InChIKey | SMIOUMBJWANLDB-KEIUHOJNSA-N |
| XLogP | 7.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|