About N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide
N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide (PubChem CID 536687) has the molecular formula C4H6N4O2
and a molecular weight of 142.12 g/mol. Its IUPAC name is N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide |
| PubChem CID | 536687 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1nonc1N |
| InChI | InChI=1S/C4H6N4O2/c1-2(9)6-4-3(5)7-10-8-4/h1H3,(H2,5,7)(H,6,8,9) |
| InChIKey | GVZQUWHSBVLLCC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide?
The IUPAC name of N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide (CID 536687) is N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide.
What is the SMILES notation for N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide?
The canonical SMILES for N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide is CC(=O)Nc1nonc1N.
What is the InChIKey of N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide?
The InChIKey is GVZQUWHSBVLLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2/c1-2(9)6-4-3(5)7-10-8-4/h1H3,(H2,5,7)(H,6,8,9).
What are the key properties of N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide?
N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide has a molecular weight of 142.12 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1,2,5-oxadiazol-3-yl)acetamide is sourced from PubChem (CID 536687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).