About (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine
(NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine (PubChem CID 5366925) has the molecular formula C7H5Cl2NO
and a molecular weight of 190.03 g/mol. Its IUPAC name is (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine |
| PubChem CID | 5366925 |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine |
| SMILES | O/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H/b10-4- |
| InChIKey | YBSXDWIAUZOFFV-WMZJFQQLSA-N |
| XLogP | 2.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine (CID 5366925) is (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine is O/N=C\c1c(Cl)cccc1Cl.
What is the InChIKey of (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine?
The InChIKey is YBSXDWIAUZOFFV-WMZJFQQLSA-N. The full InChI is InChI=1S/C7H5Cl2NO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H/b10-4-.
What are the key properties of (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine?
(NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine has a molecular weight of 190.03 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(2,6-dichlorophenyl)methylidene]hydroxylamine is sourced from PubChem (CID 5366925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).