C33H47ClO7 — CID 5367225
(11Z,14E,16E)-10-chloro-21,24-dihydroxy-5',11,13,22-tetramethyl-6'-propan-2-ylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-11,14,16,22-tetraene-6,2'-oxane]-2-one (PubChem CID 5367225) has the molecular formula C33H47ClO7 and a molecular weight of 591.19 g/mol. Its IUPAC name is (11Z,14E,16E)-10-chloro-21,24-dihydroxy-5',11,13,22-tetramethyl-6'-propan-2-ylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-11,14,16,22-tetraene-6,2'-oxane]-2-one.
| Compound Name | (11Z,14E,16E)-10-chloro-21,24-dihydroxy-5',11,13,22-tetramethyl-6'-propan-2-ylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-11,14,16,22-tetraene-6,2'-oxane]-2-one |
|---|---|
| PubChem CID | 5367225 |
| Molecular Formula | C33H47ClO7 |
| Molecular Weight | 591.19 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | (11Z,14E,16E)-10-chloro-21,24-dihydroxy-5',11,13,22-tetramethyl-6'-propan-2-ylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-11,14,16,22-tetraene-6,2'-oxane]-2-one |
| SMILES | CC1=CC2C(=O)OC3CC(CC(Cl)/C(C)=C\C(C)/C=C/C=C4\COC(C1O)C42O)OC1(CCC(C)C(C(C)C)O1)C3 |
| InChI | InChI=1S/C33H47ClO7/c1-18(2)29-20(4)10-11-32(41-29)16-25-14-24(40-32)15-27(34)21(5)12-19(3)8-7-9-23-17-38-30-28(35)22(6)13-26(31(36)39-25)33(23,30)37/h7-9,12-13,18-20,24-30,35,37H,10-11,14-17H2,1-6H3/b8-7+,21-12-,23-9+ |
| InChIKey | NCJXUYSQIFYACX-CSMIWHQNSA-N |
| XLogP | 5.39 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.19 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|