C7H10 — CID 5367392
(3E)-2-methylhexa-1,3,5-triene (PubChem CID 5367392) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is (3E)-2-methylhexa-1,3,5-triene.
| Compound Name | (3E)-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 5367392 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | (3E)-2-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C/C(=C)C |
| InChI | InChI=1S/C7H10/c1-4-5-6-7(2)3/h4-6H,1-2H2,3H3/b6-5+ |
| InChIKey | PPWGXYXJMQAWSX-AATRIKPKSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|