C21H30OS — CID 5367552
3-[(3E,7E)-3,7-dimethyl-9-phenylsulfanylnona-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 5367552) has the molecular formula C21H30OS and a molecular weight of 330.54 g/mol. Its IUPAC name is 3-[(3E,7E)-3,7-dimethyl-9-phenylsulfanylnona-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E)-3,7-dimethyl-9-phenylsulfanylnona-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 5367552 |
| Molecular Formula | C21H30OS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 3-[(3E,7E)-3,7-dimethyl-9-phenylsulfanylnona-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CSc1ccccc1)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C21H30OS/c1-17(13-14-20-21(3,4)22-20)9-8-10-18(2)15-16-23-19-11-6-5-7-12-19/h5-7,9,11-12,15,20H,8,10,13-14,16H2,1-4H3/b17-9+,18-15+ |
| InChIKey | UZLZAAYPPROHJD-LMVCELQXSA-N |
| XLogP | 6.41 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|