C14H26O — CID 5367566
(6Z)-3,7-dimethyldodeca-6,11-dien-1-ol (PubChem CID 5367566) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (6Z)-3,7-dimethyldodeca-6,11-dien-1-ol.
| Compound Name | (6Z)-3,7-dimethyldodeca-6,11-dien-1-ol |
|---|---|
| PubChem CID | 5367566 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (6Z)-3,7-dimethyldodeca-6,11-dien-1-ol |
| SMILES | C=CCCC/C(C)=C\CCC(C)CCO |
| InChI | InChI=1S/C14H26O/c1-4-5-6-8-13(2)9-7-10-14(3)11-12-15/h4,9,14-15H,1,5-8,10-12H2,2-3H3/b13-9- |
| InChIKey | DQJQTRDVPDMECA-LCYFTJDESA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|