C29H48O — CID 5367592
2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,16,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]oxirane (PubChem CID 5367592) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,16,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,16,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]oxirane |
|---|---|
| PubChem CID | 5367592 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,16,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C29H48O/c1-24(2)16-14-19-25(3)17-12-10-8-9-11-13-18-26(4)20-15-21-27(5)22-23-28-29(6,7)30-28/h8-9,16-18,21,28H,10-15,19-20,22-23H2,1-7H3/b9-8+,25-17+,26-18+,27-21+ |
| InChIKey | GJLFBTFXOMJJGN-XSLBJZTOSA-N |
| XLogP | 9.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|