About [(Z)-hex-3-enyl] oct-2-ynoate
[(Z)-hex-3-enyl] oct-2-ynoate (PubChem CID 5367687) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is [(Z)-hex-3-enyl] oct-2-ynoate.
Molecular Properties
| Compound Name | [(Z)-hex-3-enyl] oct-2-ynoate |
| PubChem CID | 5367687 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [(Z)-hex-3-enyl] oct-2-ynoate |
| SMILES | CC/C=C\CCOC(=O)C#CCCCCC |
| InChI | InChI=1S/C14H22O2/c1-3-5-7-9-10-12-14(15)16-13-11-8-6-4-2/h6,8H,3-5,7,9,11,13H2,1-2H3/b8-6- |
| InChIKey | ANJQMBWSXVCLTG-VURMDHGXSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-hex-3-enyl] oct-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-hex-3-enyl] oct-2-ynoate?
The IUPAC name of [(Z)-hex-3-enyl] oct-2-ynoate (CID 5367687) is [(Z)-hex-3-enyl] oct-2-ynoate.
What is the SMILES notation for [(Z)-hex-3-enyl] oct-2-ynoate?
The canonical SMILES for [(Z)-hex-3-enyl] oct-2-ynoate is CC/C=C\CCOC(=O)C#CCCCCC.
What is the InChIKey of [(Z)-hex-3-enyl] oct-2-ynoate?
The InChIKey is ANJQMBWSXVCLTG-VURMDHGXSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-5-7-9-10-12-14(15)16-13-11-8-6-4-2/h6,8H,3-5,7,9,11,13H2,1-2H3/b8-6-.
What are the key properties of [(Z)-hex-3-enyl] oct-2-ynoate?
[(Z)-hex-3-enyl] oct-2-ynoate has a molecular weight of 222.33 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-hex-3-enyl] oct-2-ynoate is sourced from PubChem (CID 5367687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).