C15H16F12O2 — CID 536774
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-cyclohexylacetate (PubChem CID 536774) has the molecular formula C15H16F12O2 and a molecular weight of 456.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-cyclohexylacetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 536774 |
| Molecular Formula | C15H16F12O2 |
| Molecular Weight | 456.27 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-cyclohexylacetate |
| SMILES | O=C(CC1CCCCC1)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H16F12O2/c16-10(17)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)7-29-9(28)6-8-4-2-1-3-5-8/h8,10H,1-7H2 |
| InChIKey | SZGYTKZAHKHUPF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|