C15H27NO — CID 5367883
(2E,5E)-3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol (PubChem CID 5367883) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2E,5E)-3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol.
| Compound Name | (2E,5E)-3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 5367883 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2E,5E)-3,5-dimethyl-4-(2-pyrrolidin-1-ylethyl)hepta-2,5-dien-4-ol |
| SMILES | C/C=C(\C)C(O)(CCN1CCCC1)/C(C)=C/C |
| InChI | InChI=1S/C15H27NO/c1-5-13(3)15(17,14(4)6-2)9-12-16-10-7-8-11-16/h5-6,17H,7-12H2,1-4H3/b13-5+,14-6+ |
| InChIKey | OHMZMMKVWPLNMK-ACFHMISVSA-N |
| XLogP | 3.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|