C15H26O3 — CID 5367918
(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol (PubChem CID 5367918) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol.
| Compound Name | (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 5367918 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CO |
| InChI | InChI=1S/C15H26O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,9,15-16H,3-6,8,10-12H2,1-2H3/b13-9+,14-7+ |
| InChIKey | GFZATMJPDSJPDS-BTLVJFLNSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|