C21H34O5 — CID 5367949
methyl (6E,10E)-2,6,10-trimethyl-12-(oxan-2-yloxy)-3-oxododeca-6,10-dienoate (PubChem CID 5367949) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (6E,10E)-2,6,10-trimethyl-12-(oxan-2-yloxy)-3-oxododeca-6,10-dienoate.
| Compound Name | methyl (6E,10E)-2,6,10-trimethyl-12-(oxan-2-yloxy)-3-oxododeca-6,10-dienoate |
|---|---|
| PubChem CID | 5367949 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl (6E,10E)-2,6,10-trimethyl-12-(oxan-2-yloxy)-3-oxododeca-6,10-dienoate |
| SMILES | COC(=O)C(C)C(=O)CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C21H34O5/c1-16(11-12-19(22)18(3)21(23)24-4)8-7-9-17(2)13-15-26-20-10-5-6-14-25-20/h8,13,18,20H,5-7,9-12,14-15H2,1-4H3/b16-8+,17-13+ |
| InChIKey | XQRJBPWNLHEEFR-IUIJUMGXSA-N |
| XLogP | 4.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|