C15H24O3 — CID 5367953
(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal (PubChem CID 5367953) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal.
| Compound Name | (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal |
|---|---|
| PubChem CID | 5367953 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal |
| SMILES | C/C(C=O)=C\CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C15H24O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,9,12,15H,3-6,8,10-11H2,1-2H3/b13-9+,14-7+ |
| InChIKey | WYXVNCHVXOXVRH-BTLVJFLNSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|