About oxan-2-yl (Z)-dodec-10-enoate
oxan-2-yl (Z)-dodec-10-enoate (PubChem CID 5367971) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is oxan-2-yl (Z)-dodec-10-enoate.
Molecular Properties
| Compound Name | oxan-2-yl (Z)-dodec-10-enoate |
| PubChem CID | 5367971 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | oxan-2-yl (Z)-dodec-10-enoate |
| SMILES | C/C=C\CCCCCCCCC(=O)OC1CCCCO1 |
| InChI | InChI=1S/C17H30O3/c1-2-3-4-5-6-7-8-9-10-13-16(18)20-17-14-11-12-15-19-17/h2-3,17H,4-15H2,1H3/b3-2- |
| InChIKey | ZEMBDJLQWAYNHX-IHWYPQMZSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-yl (Z)-dodec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-yl (Z)-dodec-10-enoate?
The IUPAC name of oxan-2-yl (Z)-dodec-10-enoate (CID 5367971) is oxan-2-yl (Z)-dodec-10-enoate.
What is the SMILES notation for oxan-2-yl (Z)-dodec-10-enoate?
The canonical SMILES for oxan-2-yl (Z)-dodec-10-enoate is C/C=C\CCCCCCCCC(=O)OC1CCCCO1.
What is the InChIKey of oxan-2-yl (Z)-dodec-10-enoate?
The InChIKey is ZEMBDJLQWAYNHX-IHWYPQMZSA-N. The full InChI is InChI=1S/C17H30O3/c1-2-3-4-5-6-7-8-9-10-13-16(18)20-17-14-11-12-15-19-17/h2-3,17H,4-15H2,1H3/b3-2-.
What are the key properties of oxan-2-yl (Z)-dodec-10-enoate?
oxan-2-yl (Z)-dodec-10-enoate has a molecular weight of 282.42 g/mol, XLogP of 4.75, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl (Z)-dodec-10-enoate is sourced from PubChem (CID 5367971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).