C20H30O2 — CID 5368079
2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-1,3-dioxolane (PubChem CID 5368079) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 5368079 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]-1,3-dioxolane |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C2(C)OCCO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H30O2/c1-16(8-6-13-20(5)21-14-15-22-20)10-11-18-17(2)9-7-12-19(18,3)4/h6,8,10-11,13H,7,9,12,14-15H2,1-5H3/b11-10+,13-6+,16-8+ |
| InChIKey | AETYYVKUDLBJRC-QJCODUJFSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|